C10F21NO — CID 14716460
(3R)-3-fluoro-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxaziridine (PubChem CID 14716460) has the molecular formula C10F21NO and a molecular weight of 549.07 g/mol. Its IUPAC name is (3R)-3-fluoro-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxaziridine.
| Compound Name | (3R)-3-fluoro-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxaziridine |
|---|---|
| PubChem CID | 14716460 |
| Molecular Formula | C10F21NO |
| Molecular Weight | 549.07 g/mol |
| Exact Mass | 548.96 |
| IUPAC Name | (3R)-3-fluoro-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxaziridine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)N1O[C@@]1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10F21NO/c11-1(12,3(15,16)7(23,24)25)5(19,20)9(29,30)32-10(31,33-32)6(21,22)2(13,14)4(17,18)8(26,27)28/t10-,32?/m1/s1 |
| InChIKey | KFVOFFBRJZOZJV-FLBGEPSVSA-N |
| XLogP | 6.39 |
| TPSA | 15.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.07 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|