C9F19NO — CID 11827191
(3S)-3-fluoro-2,3-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxaziridine (PubChem CID 11827191) has the molecular formula C9F19NO and a molecular weight of 499.07 g/mol. Its IUPAC name is (3S)-3-fluoro-2,3-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxaziridine.
| Compound Name | (3S)-3-fluoro-2,3-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxaziridine |
|---|---|
| PubChem CID | 11827191 |
| Molecular Formula | C9F19NO |
| Molecular Weight | 499.07 g/mol |
| Exact Mass | 498.97 |
| IUPAC Name | (3S)-3-fluoro-2,3-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxaziridine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)N1O[C@]1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9F19NO/c10-1(11,2(12,13)6(20,21)22)5(18,19)9(28)29(30-9)8(26,27)4(16,17)3(14,15)7(23,24)25/t9-,29?/m0/s1 |
| InChIKey | NEIIGTICWXZKCF-IEOOQLHTSA-N |
| XLogP | 5.75 |
| TPSA | 15.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.07 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|