C15H12N5O+ — CID 147217428
5-(1-hydroxypyridin-1-ium-3-yl)-3-(1H-pyrazol-5-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 147217428) has the molecular formula C15H12N5O+ and a molecular weight of 278.30 g/mol. Its IUPAC name is 5-(1-hydroxypyridin-1-ium-3-yl)-3-(1H-pyrazol-5-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-(1-hydroxypyridin-1-ium-3-yl)-3-(1H-pyrazol-5-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 147217428 |
| Molecular Formula | C15H12N5O+ |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-(1-hydroxypyridin-1-ium-3-yl)-3-(1H-pyrazol-5-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | O[n+]1cccc(-c2cnc3[nH]cc(-c4ccn[nH]4)c3c2)c1 |
| InChI | InChI=1S/C15H12N5O/c21-20-5-1-2-10(9-20)11-6-12-13(14-3-4-18-19-14)8-17-15(12)16-7-11/h1-9,21H,(H,16,17)(H,18,19)/q+1 |
| InChIKey | CGKAMOAZTFKVFS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|