C13H31IN2OSi — CID 147256432
N'-[3-[tert-butyl-(2-iodopropan-2-yloxy)-methylsilyl]propyl]ethane-1,2-diamine (PubChem CID 147256432) has the molecular formula C13H31IN2OSi and a molecular weight of 386.39 g/mol. Its IUPAC name is N'-[3-[tert-butyl-(2-iodopropan-2-yloxy)-methylsilyl]propyl]ethane-1,2-diamine.
| Compound Name | N'-[3-[tert-butyl-(2-iodopropan-2-yloxy)-methylsilyl]propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 147256432 |
| Molecular Formula | C13H31IN2OSi |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N'-[3-[tert-butyl-(2-iodopropan-2-yloxy)-methylsilyl]propyl]ethane-1,2-diamine |
| SMILES | CC(C)(I)O[Si](C)(CCCNCCN)C(C)(C)C |
| InChI | InChI=1S/C13H31IN2OSi/c1-12(2,3)18(6,17-13(4,5)14)11-7-9-16-10-8-15/h16H,7-11,15H2,1-6H3 |
| InChIKey | CNSCZEKYDIXFFW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|