C13H33N3OSi — CID 123546077
N'-[3-(2-aminopropan-2-yloxy-tert-butyl-methylsilyl)propyl]ethane-1,2-diamine (PubChem CID 123546077) has the molecular formula C13H33N3OSi and a molecular weight of 275.51 g/mol. Its IUPAC name is N'-[3-(2-aminopropan-2-yloxy-tert-butyl-methylsilyl)propyl]ethane-1,2-diamine.
| Compound Name | N'-[3-(2-aminopropan-2-yloxy-tert-butyl-methylsilyl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 123546077 |
| Molecular Formula | C13H33N3OSi |
| Molecular Weight | 275.51 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | N'-[3-(2-aminopropan-2-yloxy-tert-butyl-methylsilyl)propyl]ethane-1,2-diamine |
| SMILES | CC(C)(N)O[Si](C)(CCCNCCN)C(C)(C)C |
| InChI | InChI=1S/C13H33N3OSi/c1-12(2,3)18(6,17-13(4,5)15)11-7-9-16-10-8-14/h16H,7-11,14-15H2,1-6H3 |
| InChIKey | UIGNHCLTCPPMNL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|