C15H28INO2Y-2 — CID 147292069
2-iodo-N-methanidylacetamide;4-methanidyl-2,2,6,6-tetramethylheptan-3-one;yttrium (PubChem CID 147292069) has the molecular formula C15H28INO2Y-2 and a molecular weight of 470.20 g/mol. Its IUPAC name is 2-iodo-N-methanidylacetamide;4-methanidyl-2,2,6,6-tetramethylheptan-3-one;yttrium.
| Compound Name | 2-iodo-N-methanidylacetamide;4-methanidyl-2,2,6,6-tetramethylheptan-3-one;yttrium |
|---|---|
| PubChem CID | 147292069 |
| Molecular Formula | C15H28INO2Y-2 |
| Molecular Weight | 470.20 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 2-iodo-N-methanidylacetamide;4-methanidyl-2,2,6,6-tetramethylheptan-3-one;yttrium |
| SMILES | [CH2-]C(CC(C)(C)C)C(=O)C(C)(C)C.[CH2-]NC(=O)CI.[Y] |
| InChI | InChI=1S/C12H23O.C3H5INO.Y/c1-9(8-11(2,3)4)10(13)12(5,6)7;1-5-3(6)2-4;/h9H,1,8H2,2-7H3;1-2H2,(H,5,6);/q2*-1; |
| InChIKey | MIDJPBWSKHHYRY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.20 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|