C12H17BrO2S — CID 147361707
4-bromo-1-(2,2-dimethylpropylsulfonyl)-2-methylbenzene (PubChem CID 147361707) has the molecular formula C12H17BrO2S and a molecular weight of 305.24 g/mol. Its IUPAC name is 4-bromo-1-(2,2-dimethylpropylsulfonyl)-2-methylbenzene.
| Compound Name | 4-bromo-1-(2,2-dimethylpropylsulfonyl)-2-methylbenzene |
|---|---|
| PubChem CID | 147361707 |
| Molecular Formula | C12H17BrO2S |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 4-bromo-1-(2,2-dimethylpropylsulfonyl)-2-methylbenzene |
| SMILES | Cc1cc(Br)ccc1S(=O)(=O)CC(C)(C)C |
| InChI | InChI=1S/C12H17BrO2S/c1-9-7-10(13)5-6-11(9)16(14,15)8-12(2,3)4/h5-7H,8H2,1-4H3 |
| InChIKey | DHJWGLZJPFNHTP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |