C9H11O6S- — CID 147397693
2-(4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yloxy)-2-oxoethanesulfinate (PubChem CID 147397693) has the molecular formula C9H11O6S- and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-(4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yloxy)-2-oxoethanesulfinate.
| Compound Name | 2-(4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yloxy)-2-oxoethanesulfinate |
|---|---|
| PubChem CID | 147397693 |
| Molecular Formula | C9H11O6S- |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 2-(4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yloxy)-2-oxoethanesulfinate |
| SMILES | O=C(CS(=O)[O-])OC1C2CC3COC1C3O2 |
| InChI | InChI=1S/C9H12O6S/c10-6(3-16(11)12)15-8-5-1-4-2-13-9(8)7(4)14-5/h4-5,7-9H,1-3H2,(H,11,12)/p-1 |
| InChIKey | DOCQLDQWIAWCGD-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|