C13H26NO6Si- — CID 147406816
3-[[(Z)-3-carboxyprop-2-enoyl]amino]propyl-triethoxysilanuide (PubChem CID 147406816) has the molecular formula C13H26NO6Si- and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-[[(Z)-3-carboxyprop-2-enoyl]amino]propyl-triethoxysilanuide.
| Compound Name | 3-[[(Z)-3-carboxyprop-2-enoyl]amino]propyl-triethoxysilanuide |
|---|---|
| PubChem CID | 147406816 |
| Molecular Formula | C13H26NO6Si- |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-[[(Z)-3-carboxyprop-2-enoyl]amino]propyl-triethoxysilanuide |
| SMILES | CCO[SiH-](CCCNC(=O)/C=C\C(=O)O)(OCC)OCC |
| InChI | InChI=1S/C13H26NO6Si/c1-4-18-21(19-5-2,20-6-3)11-7-10-14-12(15)8-9-13(16)17/h8-9,21H,4-7,10-11H2,1-3H3,(H,14,15)(H,16,17)/q-1/b9-8- |
| InChIKey | DPVDUBNLCXLWQF-HJWRWDBZSA-N |
| XLogP | 0.91 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|