C12H21NO5Si — CID 168908388
CID 168908388 (PubChem CID 168908388) has the molecular formula C12H21NO5Si and a molecular weight of 287.39 g/mol.
| Compound Name | CID 168908388 |
|---|---|
| PubChem CID | 168908388 |
| Molecular Formula | C12H21NO5Si |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | — |
| SMILES | CCOC(OCC)[Si]CCCNC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C12H21NO5Si/c1-3-17-12(18-4-2)19-9-5-8-13-10(14)6-7-11(15)16/h6-7,12H,3-5,8-9H2,1-2H3,(H,13,14)(H,15,16)/b7-6- |
| InChIKey | UACIBPJSBMYWEN-SREVYHEPSA-N |
| XLogP | 0.61 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|