About CID 170637664
CID 170637664 (PubChem CID 170637664) has the molecular formula C11H25N3O2Si
and a molecular weight of 259.43 g/mol.
Molecular Properties
| Compound Name | CID 170637664 |
| PubChem CID | 170637664 |
| Molecular Formula | C11H25N3O2Si |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | — |
| SMILES | CCOC(OCC)[Si]CCCN/C(=N/C)NC |
| InChI | InChI=1S/C11H25N3O2Si/c1-5-15-11(16-6-2)17-9-7-8-14-10(12-3)13-4/h11H,5-9H2,1-4H3,(H2,12,13,14) |
| InChIKey | LJVQGSKGZUJTSD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 170637664 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170637664?
The IUPAC name of CID 170637664 (CID 170637664) is not available.
What is the SMILES notation for CID 170637664?
The canonical SMILES for CID 170637664 is CCOC(OCC)[Si]CCCN/C(=N/C)NC.
What is the InChIKey of CID 170637664?
The InChIKey is LJVQGSKGZUJTSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3O2Si/c1-5-15-11(16-6-2)17-9-7-8-14-10(12-3)13-4/h11H,5-9H2,1-4H3,(H2,12,13,14).
What are the key properties of CID 170637664?
CID 170637664 has a molecular weight of 259.43 g/mol, XLogP of 0.65, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170637664 is sourced from PubChem (CID 170637664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).