C20H20N2O5 — CID 147472862
4-(6-cyclopropyl-4-nitrocyclohexa-2,4-dien-1-yl)oxy-6,7-dimethoxyquinoline (PubChem CID 147472862) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 4-(6-cyclopropyl-4-nitrocyclohexa-2,4-dien-1-yl)oxy-6,7-dimethoxyquinoline.
| Compound Name | 4-(6-cyclopropyl-4-nitrocyclohexa-2,4-dien-1-yl)oxy-6,7-dimethoxyquinoline |
|---|---|
| PubChem CID | 147472862 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-(6-cyclopropyl-4-nitrocyclohexa-2,4-dien-1-yl)oxy-6,7-dimethoxyquinoline |
| SMILES | COc1cc2nccc(OC3C=CC([N+](=O)[O-])=CC3C3CC3)c2cc1OC |
| InChI | InChI=1S/C20H20N2O5/c1-25-19-10-15-16(11-20(19)26-2)21-8-7-18(15)27-17-6-5-13(22(23)24)9-14(17)12-3-4-12/h5-12,14,17H,3-4H2,1-2H3 |
| InChIKey | FCCVPYPOWANHBM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|