C16H16FN3O5 — CID 163766229
(1E,3E)-5-(6,7-dimethoxyquinolin-4-yl)oxy-4-fluoro-2-nitropenta-1,3-dien-1-amine (PubChem CID 163766229) has the molecular formula C16H16FN3O5 and a molecular weight of 349.32 g/mol. Its IUPAC name is (1E,3E)-5-(6,7-dimethoxyquinolin-4-yl)oxy-4-fluoro-2-nitropenta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-5-(6,7-dimethoxyquinolin-4-yl)oxy-4-fluoro-2-nitropenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163766229 |
| Molecular Formula | C16H16FN3O5 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (1E,3E)-5-(6,7-dimethoxyquinolin-4-yl)oxy-4-fluoro-2-nitropenta-1,3-dien-1-amine |
| SMILES | COc1cc2nccc(OC/C(F)=C\C(=C/N)[N+](=O)[O-])c2cc1OC |
| InChI | InChI=1S/C16H16FN3O5/c1-23-15-6-12-13(7-16(15)24-2)19-4-3-14(12)25-9-10(17)5-11(8-18)20(21)22/h3-8H,9,18H2,1-2H3/b10-5+,11-8+ |
| InChIKey | MCMQAEPZNRNWRY-TVNUJMIRSA-N |
| XLogP | 2.56 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|