C5H7ClN2O — CID 147798893
5-chloro-4-methyl-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 147798893) has the molecular formula C5H7ClN2O and a molecular weight of 146.58 g/mol. Its IUPAC name is 5-chloro-4-methyl-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 147798893 |
| Molecular Formula | C5H7ClN2O |
| Molecular Weight | 146.58 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | 5-chloro-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CC1C=NNC(=O)C1Cl |
| InChI | InChI=1S/C5H7ClN2O/c1-3-2-7-8-5(9)4(3)6/h2-4H,1H3,(H,8,9) |
| InChIKey | HLCLVAGCLBLMFZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.58 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|