C7HF15O — CID 14832369
1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-(1,1,2,2-tetrafluoroethoxy)pentane (PubChem CID 14832369) has the molecular formula C7HF15O and a molecular weight of 386.05 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-(1,1,2,2-tetrafluoroethoxy)pentane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-(1,1,2,2-tetrafluoroethoxy)pentane |
|---|---|
| PubChem CID | 14832369 |
| Molecular Formula | C7HF15O |
| Molecular Weight | 386.05 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-(1,1,2,2-tetrafluoroethoxy)pentane |
| SMILES | FC(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7HF15O/c8-1(9)2(10,11)23-7(21,22)5(16,17)3(12,13)4(14,15)6(18,19)20/h1H |
| InChIKey | KNGOJJDRHVWZIR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.05 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|