C29H23NO12S — CID 148632964
methyl 4-[5-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-hydroxymethyl]-7-methoxy-1,3-benzodioxol-4-yl]-7-methoxy-1,3-benzodioxole-5-carboxylate (PubChem CID 148632964) has the molecular formula C29H23NO12S and a molecular weight of 609.57 g/mol. Its IUPAC name is methyl 4-[5-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-hydroxymethyl]-7-methoxy-1,3-benzodioxol-4-yl]-7-methoxy-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl 4-[5-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-hydroxymethyl]-7-methoxy-1,3-benzodioxol-4-yl]-7-methoxy-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 148632964 |
| Molecular Formula | C29H23NO12S |
| Molecular Weight | 609.57 g/mol |
| Exact Mass | 609.09 |
| IUPAC Name | methyl 4-[5-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-hydroxymethyl]-7-methoxy-1,3-benzodioxol-4-yl]-7-methoxy-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)c1cc(OC)c2c(c1-c1c(C(O)Oc3ccc(/C=C4\SC(=O)NC4=O)cc3)cc(OC)c3c1OCO3)OCO2 |
| InChI | InChI=1S/C29H23NO12S/c1-35-17-9-15(27(32)37-3)20(24-22(17)38-11-40-24)21-16(10-18(36-2)23-25(21)41-12-39-23)28(33)42-14-6-4-13(5-7-14)8-19-26(31)30-29(34)43-19/h4-10,28,33H,11-12H2,1-3H3,(H,30,31,34)/b19-8- |
| InChIKey | NINAVAOQLJQTTH-UWVJOHFNSA-N |
| XLogP | 4.01 |
| TPSA | 157.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|