C28H16N2O5 — CID 148772839
[1,3-dioxo-2-(4-oxo-3H-quinazolin-2-yl)cyclopenta[g]naphthalen-5-yl] benzoate (PubChem CID 148772839) has the molecular formula C28H16N2O5 and a molecular weight of 460.45 g/mol. Its IUPAC name is [1,3-dioxo-2-(4-oxo-3H-quinazolin-2-yl)cyclopenta[g]naphthalen-5-yl] benzoate.
| Compound Name | [1,3-dioxo-2-(4-oxo-3H-quinazolin-2-yl)cyclopenta[g]naphthalen-5-yl] benzoate |
|---|---|
| PubChem CID | 148772839 |
| Molecular Formula | C28H16N2O5 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [1,3-dioxo-2-(4-oxo-3H-quinazolin-2-yl)cyclopenta[g]naphthalen-5-yl] benzoate |
| SMILES | O=C(Oc1cccc2cc3c(cc12)C(=O)C(c1nc2ccccc2c(=O)[nH]1)C3=O)c1ccccc1 |
| InChI | InChI=1S/C28H16N2O5/c31-24-19-13-16-9-6-12-22(35-28(34)15-7-2-1-3-8-15)18(16)14-20(19)25(32)23(24)26-29-21-11-5-4-10-17(21)27(33)30-26/h1-14,23H,(H,29,30,33) |
| InChIKey | OITCMYDUOSDUKP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|