C30H21N3O5 — CID 135998538
2-(3-cyclopentylphenyl)-6-(4-oxo-3H-quinazolin-2-yl)cyclopenta[f]isoindole-1,3,5,7-tetrone (PubChem CID 135998538) has the molecular formula C30H21N3O5 and a molecular weight of 503.51 g/mol. Its IUPAC name is 2-(3-cyclopentylphenyl)-6-(4-oxo-3H-quinazolin-2-yl)cyclopenta[f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-(3-cyclopentylphenyl)-6-(4-oxo-3H-quinazolin-2-yl)cyclopenta[f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 135998538 |
| Molecular Formula | C30H21N3O5 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 2-(3-cyclopentylphenyl)-6-(4-oxo-3H-quinazolin-2-yl)cyclopenta[f]isoindole-1,3,5,7-tetrone |
| SMILES | O=C1c2cc3c(cc2C(=O)C1c1nc2ccccc2c(=O)[nH]1)C(=O)N(c1cccc(C2CCCC2)c1)C3=O |
| InChI | InChI=1S/C30H21N3O5/c34-25-19-13-21-22(30(38)33(29(21)37)17-9-5-8-16(12-17)15-6-1-2-7-15)14-20(19)26(35)24(25)27-31-23-11-4-3-10-18(23)28(36)32-27/h3-5,8-15,24H,1-2,6-7H2,(H,31,32,36) |
| InChIKey | LZEJEGOIYPRTED-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|