C30H52F3N3O4 — CID 148834593
tert-butyl (4S)-2-[hydroxy-[[(9Z,12Z)-octadeca-9,12-dienyl]amino]methyl]-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1-carboxylate (PubChem CID 148834593) has the molecular formula C30H52F3N3O4 and a molecular weight of 575.76 g/mol. Its IUPAC name is tert-butyl (4S)-2-[hydroxy-[[(9Z,12Z)-octadeca-9,12-dienyl]amino]methyl]-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-2-[hydroxy-[[(9Z,12Z)-octadeca-9,12-dienyl]amino]methyl]-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 148834593 |
| Molecular Formula | C30H52F3N3O4 |
| Molecular Weight | 575.76 g/mol |
| Exact Mass | 575.39 |
| IUPAC Name | tert-butyl (4S)-2-[hydroxy-[[(9Z,12Z)-octadeca-9,12-dienyl]amino]methyl]-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCNC(O)C1C[C@H](NC(=O)C(F)(F)F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H52F3N3O4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-34-26(37)25-22-24(35-27(38)30(31,32)33)23-36(25)28(39)40-29(2,3)4/h9-10,12-13,24-26,34,37H,5-8,11,14-23H2,1-4H3,(H,35,38)/b10-9-,13-12-/t24-,25?,26?/m0/s1 |
| InChIKey | OUINZOWBMYEEDJ-HMCOLWGYSA-N |
| XLogP | 6.76 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.76 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|