C13H15F3N4S — CID 149159402
3-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)-2H-1,2,4-benzothiadiazine (PubChem CID 149159402) has the molecular formula C13H15F3N4S and a molecular weight of 316.35 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)-2H-1,2,4-benzothiadiazine.
| Compound Name | 3-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)-2H-1,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 149159402 |
| Molecular Formula | C13H15F3N4S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-6-(trifluoromethyl)-2H-1,2,4-benzothiadiazine |
| SMILES | CN1CCN(C2=Nc3cc(C(F)(F)F)ccc3SN2)CC1 |
| InChI | InChI=1S/C13H15F3N4S/c1-19-4-6-20(7-5-19)12-17-10-8-9(13(14,15)16)2-3-11(10)21-18-12/h2-3,8H,4-7H2,1H3,(H,17,18) |
| InChIKey | GCZAVDKWAGBMTN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|