C9H10NO2+ — CID 149204826
7-methyl-2H-1,4-benzoxazin-4-ium-3-ol (PubChem CID 149204826) has the molecular formula C9H10NO2+ and a molecular weight of 164.18 g/mol. Its IUPAC name is 7-methyl-2H-1,4-benzoxazin-4-ium-3-ol.
| Compound Name | 7-methyl-2H-1,4-benzoxazin-4-ium-3-ol |
|---|---|
| PubChem CID | 149204826 |
| Molecular Formula | C9H10NO2+ |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 7-methyl-2H-1,4-benzoxazin-4-ium-3-ol |
| SMILES | Cc1ccc2c(c1)OCC(O)=[NH+]2 |
| InChI | InChI=1S/C9H9NO2/c1-6-2-3-7-8(4-6)12-5-9(11)10-7/h2-4H,5H2,1H3,(H,10,11)/p+1 |
| InChIKey | XFJYLKINYUFREU-UHFFFAOYSA-O |
| XLogP | 0.06 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |