C6H10I2 — CID 149209200
1,2-diiodo-3-methylcyclopentane (PubChem CID 149209200) has the molecular formula C6H10I2 and a molecular weight of 335.95 g/mol. Its IUPAC name is 1,2-diiodo-3-methylcyclopentane.
| Compound Name | 1,2-diiodo-3-methylcyclopentane |
|---|---|
| PubChem CID | 149209200 |
| Molecular Formula | C6H10I2 |
| Molecular Weight | 335.95 g/mol |
| Exact Mass | 335.89 |
| IUPAC Name | 1,2-diiodo-3-methylcyclopentane |
| SMILES | CC1CCC(I)C1I |
| InChI | InChI=1S/C6H10I2/c1-4-2-3-5(7)6(4)8/h4-6H,2-3H2,1H3 |
| InChIKey | XGFXWZDIKXUEFD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.95 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|