C19H30O2S — CID 14934690
(E)-1-methoxy-3-methyl-3-phenylsulfanylundec-1-en-5-ol (PubChem CID 14934690) has the molecular formula C19H30O2S and a molecular weight of 322.51 g/mol. Its IUPAC name is (E)-1-methoxy-3-methyl-3-phenylsulfanylundec-1-en-5-ol.
| Compound Name | (E)-1-methoxy-3-methyl-3-phenylsulfanylundec-1-en-5-ol |
|---|---|
| PubChem CID | 14934690 |
| Molecular Formula | C19H30O2S |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (E)-1-methoxy-3-methyl-3-phenylsulfanylundec-1-en-5-ol |
| SMILES | CCCCCCC(O)CC(C)(/C=C/OC)Sc1ccccc1 |
| InChI | InChI=1S/C19H30O2S/c1-4-5-6-8-11-17(20)16-19(2,14-15-21-3)22-18-12-9-7-10-13-18/h7,9-10,12-15,17,20H,4-6,8,11,16H2,1-3H3/b15-14+ |
| InChIKey | UDHCTQTVAHXAFS-CCEZHUSRSA-N |
| XLogP | 5.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|