C44H44N2O4S — CID 149356051
9H-fluoren-9-ylmethyl 8-[[(2R)-1-amino-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-8-oxooctanoate (PubChem CID 149356051) has the molecular formula C44H44N2O4S and a molecular weight of 696.91 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 8-[[(2R)-1-amino-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-8-oxooctanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 8-[[(2R)-1-amino-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-8-oxooctanoate |
|---|---|
| PubChem CID | 149356051 |
| Molecular Formula | C44H44N2O4S |
| Molecular Weight | 696.91 g/mol |
| Exact Mass | 696.30 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 8-[[(2R)-1-amino-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-8-oxooctanoate |
| SMILES | NC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CCCCCCC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C44H44N2O4S/c45-43(49)40(31-51-44(32-18-6-3-7-19-32,33-20-8-4-9-21-33)34-22-10-5-11-23-34)46-41(47)28-12-1-2-13-29-42(48)50-30-39-37-26-16-14-24-35(37)36-25-15-17-27-38(36)39/h3-11,14-27,39-40H,1-2,12-13,28-31H2,(H2,45,49)(H,46,47)/t40-/m0/s1 |
| InChIKey | YGYVGWLYHZPVJD-FAIXQHPJSA-N |
| XLogP | 8.38 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.91 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|