C39H34N2O4S — CID 175707572
9H-fluoren-9-ylmethyl (3R)-3-[(2-aminoacetyl)amino]-2-oxo-4-tritylsulfanylbutanoate (PubChem CID 175707572) has the molecular formula C39H34N2O4S and a molecular weight of 626.78 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (3R)-3-[(2-aminoacetyl)amino]-2-oxo-4-tritylsulfanylbutanoate.
| Compound Name | 9H-fluoren-9-ylmethyl (3R)-3-[(2-aminoacetyl)amino]-2-oxo-4-tritylsulfanylbutanoate |
|---|---|
| PubChem CID | 175707572 |
| Molecular Formula | C39H34N2O4S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (3R)-3-[(2-aminoacetyl)amino]-2-oxo-4-tritylsulfanylbutanoate |
| SMILES | NCC(=O)N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C39H34N2O4S/c40-24-36(42)41-35(37(43)38(44)45-25-34-32-22-12-10-20-30(32)31-21-11-13-23-33(31)34)26-46-39(27-14-4-1-5-15-27,28-16-6-2-7-17-28)29-18-8-3-9-19-29/h1-23,34-35H,24-26,40H2,(H,41,42)/t35-/m0/s1 |
| InChIKey | GEEXDCVXBIMBOZ-DHUJRADRSA-N |
| XLogP | 6.08 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|