C21H23ClN2S — CID 149419062
N-[1-(3-chlorophenyl)ethyl]spiro[1,4-dihydroquinoline-3,4'-thiane]-2-imine (PubChem CID 149419062) has the molecular formula C21H23ClN2S and a molecular weight of 370.95 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]spiro[1,4-dihydroquinoline-3,4'-thiane]-2-imine.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]spiro[1,4-dihydroquinoline-3,4'-thiane]-2-imine |
|---|---|
| PubChem CID | 149419062 |
| Molecular Formula | C21H23ClN2S |
| Molecular Weight | 370.95 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]spiro[1,4-dihydroquinoline-3,4'-thiane]-2-imine |
| SMILES | CC(/N=C1\Nc2ccccc2CC12CCSCC2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H23ClN2S/c1-15(16-6-4-7-18(22)13-16)23-20-21(9-11-25-12-10-21)14-17-5-2-3-8-19(17)24-20/h2-8,13,15H,9-12,14H2,1H3,(H,23,24) |
| InChIKey | YSTOYKDUTHSUKR-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.95 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|