C20H25NO — CID 14982716
2-(2-benzyl-7-ethyl-1,3-dihydroisoindol-5-yl)propan-2-ol (PubChem CID 14982716) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-(2-benzyl-7-ethyl-1,3-dihydroisoindol-5-yl)propan-2-ol.
| Compound Name | 2-(2-benzyl-7-ethyl-1,3-dihydroisoindol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 14982716 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-(2-benzyl-7-ethyl-1,3-dihydroisoindol-5-yl)propan-2-ol |
| SMILES | CCc1cc(C(C)(C)O)cc2c1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C20H25NO/c1-4-16-10-18(20(2,3)22)11-17-13-21(14-19(16)17)12-15-8-6-5-7-9-15/h5-11,22H,4,12-14H2,1-3H3 |
| InChIKey | HPHJOTJTPCNVIC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |