C19H14O6S — CID 14988611
8-(3,4-dimethoxyphenyl)-4-methoxythieno[2,3-f][2]benzofuran-5,7-dione (PubChem CID 14988611) has the molecular formula C19H14O6S and a molecular weight of 370.38 g/mol. Its IUPAC name is 8-(3,4-dimethoxyphenyl)-4-methoxythieno[2,3-f][2]benzofuran-5,7-dione.
| Compound Name | 8-(3,4-dimethoxyphenyl)-4-methoxythieno[2,3-f][2]benzofuran-5,7-dione |
|---|---|
| PubChem CID | 14988611 |
| Molecular Formula | C19H14O6S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 8-(3,4-dimethoxyphenyl)-4-methoxythieno[2,3-f][2]benzofuran-5,7-dione |
| SMILES | COc1ccc(-c2c3c(c(OC)c4ccsc24)C(=O)OC3=O)cc1OC |
| InChI | InChI=1S/C19H14O6S/c1-22-11-5-4-9(8-12(11)23-2)13-14-15(19(21)25-18(14)20)16(24-3)10-6-7-26-17(10)13/h4-8H,1-3H3 |
| InChIKey | JTFCVHURPUUJJH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|