C21H19F4N3O3S — CID 150155276
3-[2-ethyl-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-ethynyl-5-fluoro-2-(methanesulfonamido)phenyl]methyl]prop-2-enamide (PubChem CID 150155276) has the molecular formula C21H19F4N3O3S and a molecular weight of 469.46 g/mol. Its IUPAC name is 3-[2-ethyl-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-ethynyl-5-fluoro-2-(methanesulfonamido)phenyl]methyl]prop-2-enamide.
| Compound Name | 3-[2-ethyl-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-ethynyl-5-fluoro-2-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 150155276 |
| Molecular Formula | C21H19F4N3O3S |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 3-[2-ethyl-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-ethynyl-5-fluoro-2-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
| SMILES | C#Cc1cc(F)cc(CNC(=O)C=Cc2ccc(C(F)(F)F)nc2CC)c1NS(C)(=O)=O |
| InChI | InChI=1S/C21H19F4N3O3S/c1-4-13-10-16(22)11-15(20(13)28-32(3,30)31)12-26-19(29)9-7-14-6-8-18(21(23,24)25)27-17(14)5-2/h1,6-11,28H,5,12H2,2-3H3,(H,26,29) |
| InChIKey | FGCGNAKXJSWTMW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|