C25H18F5N3O4S — CID 90339523
N-[[5-ethynyl-2-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(4-fluorophenoxy)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 90339523) has the molecular formula C25H18F5N3O4S and a molecular weight of 551.49 g/mol. Its IUPAC name is N-[[5-ethynyl-2-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(4-fluorophenoxy)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[[5-ethynyl-2-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(4-fluorophenoxy)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 90339523 |
| Molecular Formula | C25H18F5N3O4S |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | N-[[5-ethynyl-2-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(4-fluorophenoxy)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)C=Cc2ccc(C(F)(F)F)nc2Oc2ccc(F)cc2)c(F)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C25H18F5N3O4S/c1-3-15-12-17(20(27)13-21(15)33-38(2,35)36)14-31-23(34)11-5-16-4-10-22(25(28,29)30)32-24(16)37-19-8-6-18(26)7-9-19/h1,4-13,33H,14H2,2H3,(H,31,34) |
| InChIKey | XVPMJHCODFMINZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|