C25H17AsF5N2O4S — CID 87689489
CID 87689489 (PubChem CID 87689489) has the molecular formula C25H17AsF5N2O4S and a molecular weight of 611.40 g/mol.
| Compound Name | CID 87689489 |
|---|---|
| PubChem CID | 87689489 |
| Molecular Formula | C25H17AsF5N2O4S |
| Molecular Weight | 611.40 g/mol |
| Exact Mass | 611.00 |
| IUPAC Name | — |
| SMILES | C#Cc1cc(CNC(=O)C=Cc2ccc(C(F)(F)F)nc2Oc2ccc(F)cc2)cc(F)c1[As]S(C)(=O)=O |
| InChI | InChI=1S/C25H17AsF5N2O4S/c1-3-16-12-15(13-20(28)23(16)26-38(2,35)36)14-32-22(34)11-5-17-4-10-21(25(29,30)31)33-24(17)37-19-8-6-18(27)7-9-19/h1,4-13H,14H2,2H3,(H,32,34) |
| InChIKey | ZEDLFYNCBXOOHK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|