C9H9BrS2 — CID 150448843
5-bromo-2-propylthieno[3,2-b]thiophene (PubChem CID 150448843) has the molecular formula C9H9BrS2 and a molecular weight of 261.21 g/mol. Its IUPAC name is 5-bromo-2-propylthieno[3,2-b]thiophene.
| Compound Name | 5-bromo-2-propylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 150448843 |
| Molecular Formula | C9H9BrS2 |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 259.93 |
| IUPAC Name | 5-bromo-2-propylthieno[3,2-b]thiophene |
| SMILES | CCCc1cc2sc(Br)cc2s1 |
| InChI | InChI=1S/C9H9BrS2/c1-2-3-6-4-7-8(11-6)5-9(10)12-7/h4-5H,2-3H2,1H3 |
| InChIKey | HNIRVMOKQSGVQB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |