About 5-bromo-2-propylthieno[3,2-b]thiophene
5-bromo-2-propylthieno[3,2-b]thiophene (PubChem CID 150448843) has the molecular formula C9H9BrS2
and a molecular weight of 261.21 g/mol. Its IUPAC name is 5-bromo-2-propylthieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 5-bromo-2-propylthieno[3,2-b]thiophene |
| PubChem CID | 150448843 |
| Molecular Formula | C9H9BrS2 |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 259.93 |
| IUPAC Name | 5-bromo-2-propylthieno[3,2-b]thiophene |
| SMILES | CCCc1cc2sc(Br)cc2s1 |
| InChI | InChI=1S/C9H9BrS2/c1-2-3-6-4-7-8(11-6)5-9(10)12-7/h4-5H,2-3H2,1H3 |
| InChIKey | HNIRVMOKQSGVQB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2-propylthieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-propylthieno[3,2-b]thiophene?
The IUPAC name of 5-bromo-2-propylthieno[3,2-b]thiophene (CID 150448843) is 5-bromo-2-propylthieno[3,2-b]thiophene.
What is the SMILES notation for 5-bromo-2-propylthieno[3,2-b]thiophene?
The canonical SMILES for 5-bromo-2-propylthieno[3,2-b]thiophene is CCCc1cc2sc(Br)cc2s1.
What is the InChIKey of 5-bromo-2-propylthieno[3,2-b]thiophene?
The InChIKey is HNIRVMOKQSGVQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrS2/c1-2-3-6-4-7-8(11-6)5-9(10)12-7/h4-5H,2-3H2,1H3.
What are the key properties of 5-bromo-2-propylthieno[3,2-b]thiophene?
5-bromo-2-propylthieno[3,2-b]thiophene has a molecular weight of 261.21 g/mol, XLogP of 4.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-propylthieno[3,2-b]thiophene is sourced from PubChem (CID 150448843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).