C18H13BrF2S2 — CID 162450809
5-bromo-2-[2-(4-butyl-2,6-difluorophenyl)ethynyl]thieno[3,2-b]thiophene (PubChem CID 162450809) has the molecular formula C18H13BrF2S2 and a molecular weight of 411.34 g/mol. Its IUPAC name is 5-bromo-2-[2-(4-butyl-2,6-difluorophenyl)ethynyl]thieno[3,2-b]thiophene.
| Compound Name | 5-bromo-2-[2-(4-butyl-2,6-difluorophenyl)ethynyl]thieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 162450809 |
| Molecular Formula | C18H13BrF2S2 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | 5-bromo-2-[2-(4-butyl-2,6-difluorophenyl)ethynyl]thieno[3,2-b]thiophene |
| SMILES | CCCCc1cc(F)c(C#Cc2cc3sc(Br)cc3s2)c(F)c1 |
| InChI | InChI=1S/C18H13BrF2S2/c1-2-3-4-11-7-14(20)13(15(21)8-11)6-5-12-9-16-17(22-12)10-18(19)23-16/h7-10H,2-4H2,1H3 |
| InChIKey | YFSPVYITRQPNDI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|