C4H8Br2N2 — CID 150457500
3,5-dibromopyrrolidin-2-amine (PubChem CID 150457500) has the molecular formula C4H8Br2N2 and a molecular weight of 243.93 g/mol. Its IUPAC name is 3,5-dibromopyrrolidin-2-amine.
| Compound Name | 3,5-dibromopyrrolidin-2-amine |
|---|---|
| PubChem CID | 150457500 |
| Molecular Formula | C4H8Br2N2 |
| Molecular Weight | 243.93 g/mol |
| Exact Mass | 241.91 |
| IUPAC Name | 3,5-dibromopyrrolidin-2-amine |
| SMILES | NC1NC(Br)CC1Br |
| InChI | InChI=1S/C4H8Br2N2/c5-2-1-3(6)8-4(2)7/h2-4,8H,1,7H2 |
| InChIKey | HPBZVBMAGYCDCG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.93 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|