C13H24N2 — CID 150517578
N'-cyclohexyl-N,N-dimethylpent-2-enimidamide (PubChem CID 150517578) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N'-cyclohexyl-N,N-dimethylpent-2-enimidamide.
| Compound Name | N'-cyclohexyl-N,N-dimethylpent-2-enimidamide |
|---|---|
| PubChem CID | 150517578 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N'-cyclohexyl-N,N-dimethylpent-2-enimidamide |
| SMILES | CCC=C/C(=N\C1CCCCC1)N(C)C |
| InChI | InChI=1S/C13H24N2/c1-4-5-11-13(15(2)3)14-12-9-7-6-8-10-12/h5,11-12H,4,6-10H2,1-3H3/b11-5?,14-13+ |
| InChIKey | IBDDUSGMZRBBTI-LMGCAIFZSA-N |
| XLogP | 3.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|