C7H8O5S2 — CID 150519078
6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 150519078) has the molecular formula C7H8O5S2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 150519078 |
| Molecular Formula | C7H8O5S2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C=CC=CC1(S)S(=O)(=O)O |
| InChI | InChI=1S/C7H8O5S2/c8-6(9)5-3-1-2-4-7(5,13)14(10,11)12/h1-5,13H,(H,8,9)(H,10,11,12) |
| InChIKey | IBLDTIPYBMPFFB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|