6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid

C7H8O5S2 — CID 150519078

IUPAC6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1C=CC=CC1(S)S(=O)(=O)O
InChIInChI=1S/C7H8O5S2/c8-6(9)5-3-1-2-4-7(5,13)14(10,11)12/h1-5,13H,(H,8,9)(H,10,11,12)
InChIKeyIBLDTIPYBMPFFB-UHFFFAOYSA-N
MW236.27 g/mol
LogP0.33
Rot. Bonds2

About 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid

6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 150519078) has the molecular formula C7H8O5S2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid
PubChem CID150519078
Molecular FormulaC7H8O5S2
Molecular Weight236.27 g/mol
Exact Mass235.98
IUPAC Name6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1C=CC=CC1(S)S(=O)(=O)O
InChIInChI=1S/C7H8O5S2/c8-6(9)5-3-1-2-4-7(5,13)14(10,11)12/h1-5,13H,(H,8,9)(H,10,11,12)
InChIKeyIBLDTIPYBMPFFB-UHFFFAOYSA-N
XLogP0.33
TPSA91.67 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.27
LogP ≤ 50.33
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid (CID 150519078) is 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1C=CC=CC1(S)S(=O)(=O)O.
What is the InChIKey of 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is IBLDTIPYBMPFFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O5S2/c8-6(9)5-3-1-2-4-7(5,13)14(10,11)12/h1-5,13H,(H,8,9)(H,10,11,12).
What are the key properties of 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid?
6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 236.27 g/mol, XLogP of 0.33, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfanyl-6-sulfocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 150519078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).