C24H30O6 — CID 150643269
2-(6-butoxy-3-phenoxyhexoxy)carbonylbenzoic acid (PubChem CID 150643269) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-(6-butoxy-3-phenoxyhexoxy)carbonylbenzoic acid.
| Compound Name | 2-(6-butoxy-3-phenoxyhexoxy)carbonylbenzoic acid |
|---|---|
| PubChem CID | 150643269 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 2-(6-butoxy-3-phenoxyhexoxy)carbonylbenzoic acid |
| SMILES | CCCCOCCCC(CCOC(=O)c1ccccc1C(=O)O)Oc1ccccc1 |
| InChI | InChI=1S/C24H30O6/c1-2-3-16-28-17-9-12-20(30-19-10-5-4-6-11-19)15-18-29-24(27)22-14-8-7-13-21(22)23(25)26/h4-8,10-11,13-14,20H,2-3,9,12,15-18H2,1H3,(H,25,26) |
| InChIKey | JAIXXBSDUXXBCT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|