C21H15ClN4O4S2 — CID 150683239
5-(4-amino-5-benzoyl-2-sulfanylidene-3H-benzimidazole-1-carbonyl)-2-chlorobenzenesulfonamide (PubChem CID 150683239) has the molecular formula C21H15ClN4O4S2 and a molecular weight of 486.96 g/mol. Its IUPAC name is 5-(4-amino-5-benzoyl-2-sulfanylidene-3H-benzimidazole-1-carbonyl)-2-chlorobenzenesulfonamide.
| Compound Name | 5-(4-amino-5-benzoyl-2-sulfanylidene-3H-benzimidazole-1-carbonyl)-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 150683239 |
| Molecular Formula | C21H15ClN4O4S2 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 5-(4-amino-5-benzoyl-2-sulfanylidene-3H-benzimidazole-1-carbonyl)-2-chlorobenzenesulfonamide |
| SMILES | Nc1c(C(=O)c2ccccc2)ccc2c1[nH]c(=S)n2C(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C21H15ClN4O4S2/c22-14-8-6-12(10-16(14)32(24,29)30)20(28)26-15-9-7-13(17(23)18(15)25-21(26)31)19(27)11-4-2-1-3-5-11/h1-10H,23H2,(H,25,31)(H2,24,29,30) |
| InChIKey | JIHXKTGKQUGAQN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 141.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|