C21H35NO2 — CID 15069743
N-[(2E,6E,10E)-2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienyl]propanamide (PubChem CID 15069743) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is N-[(2E,6E,10E)-2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienyl]propanamide.
| Compound Name | N-[(2E,6E,10E)-2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienyl]propanamide |
|---|---|
| PubChem CID | 15069743 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | N-[(2E,6E,10E)-2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienyl]propanamide |
| SMILES | CCC(=O)NC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC(C)=O |
| InChI | InChI=1S/C21H35NO2/c1-6-21(24)22-16-19(4)14-8-12-17(2)10-7-11-18(3)13-9-15-20(5)23/h10,13-14H,6-9,11-12,15-16H2,1-5H3,(H,22,24)/b17-10+,18-13+,19-14+ |
| InChIKey | PQJIJASPIQSHAC-ZPIGZSNLSA-N |
| XLogP | 5.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|