C32H52INO — CID 91030593
N-(2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl)-2-iodoacetamide (PubChem CID 91030593) has the molecular formula C32H52INO and a molecular weight of 593.68 g/mol. Its IUPAC name is N-(2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl)-2-iodoacetamide.
| Compound Name | N-(2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl)-2-iodoacetamide |
|---|---|
| PubChem CID | 91030593 |
| Molecular Formula | C32H52INO |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.31 |
| IUPAC Name | N-(2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl)-2-iodoacetamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)CNC(=O)CI |
| InChI | InChI=1S/C32H52INO/c1-26(2)14-10-17-29(5)20-11-18-27(3)15-8-9-16-28(4)19-12-21-30(6)22-13-23-31(7)25-34-32(35)24-33/h14-16,20-21,23H,8-13,17-19,22,24-25H2,1-7H3,(H,34,35) |
| InChIKey | ARUUNVZTINHOGH-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|