C34H56N2O2 — CID 5366118
N-[(6E,10E,14E,18E)-13-acetamido-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-12-yl]acetamide (PubChem CID 5366118) has the molecular formula C34H56N2O2 and a molecular weight of 524.83 g/mol. Its IUPAC name is N-[(6E,10E,14E,18E)-13-acetamido-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-12-yl]acetamide.
| Compound Name | N-[(6E,10E,14E,18E)-13-acetamido-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-12-yl]acetamide |
|---|---|
| PubChem CID | 5366118 |
| Molecular Formula | C34H56N2O2 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.43 |
| IUPAC Name | N-[(6E,10E,14E,18E)-13-acetamido-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-12-yl]acetamide |
| SMILES | CC(=O)NC(/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(/C=C(\C)CC/C=C(\C)CCC=C(C)C)NC(C)=O |
| InChI | InChI=1S/C34H56N2O2/c1-25(2)15-11-17-27(5)19-13-21-29(7)23-33(35-31(9)37)34(36-32(10)38)24-30(8)22-14-20-28(6)18-12-16-26(3)4/h15-16,19-20,23-24,33-34H,11-14,17-18,21-22H2,1-10H3,(H,35,37)(H,36,38)/b27-19+,28-20+,29-23+,30-24+ |
| InChIKey | BFSWZHSYEFUDNH-MTSVODCTSA-N |
| XLogP | 8.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|