C5H2F3O3- — CID 150725472
4,4,4-trifluoro-2-methylidene-3-oxobutanoate (PubChem CID 150725472) has the molecular formula C5H2F3O3- and a molecular weight of 167.06 g/mol. Its IUPAC name is 4,4,4-trifluoro-2-methylidene-3-oxobutanoate.
| Compound Name | 4,4,4-trifluoro-2-methylidene-3-oxobutanoate |
|---|---|
| PubChem CID | 150725472 |
| Molecular Formula | C5H2F3O3- |
| Molecular Weight | 167.06 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | 4,4,4-trifluoro-2-methylidene-3-oxobutanoate |
| SMILES | C=C(C(=O)[O-])C(=O)C(F)(F)F |
| InChI | InChI=1S/C5H3F3O3/c1-2(4(10)11)3(9)5(6,7)8/h1H2,(H,10,11)/p-1 |
| InChIKey | JQSWJKIALAQUTL-UHFFFAOYSA-M |
| XLogP | -0.58 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.06 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|