C5H8O2S — CID 15073115
4-ethyl-1,3-dioxolane-2-thione (PubChem CID 15073115) has the molecular formula C5H8O2S and a molecular weight of 132.18 g/mol. Its IUPAC name is 4-ethyl-1,3-dioxolane-2-thione.
| Compound Name | 4-ethyl-1,3-dioxolane-2-thione |
|---|---|
| PubChem CID | 15073115 |
| Molecular Formula | C5H8O2S |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | 4-ethyl-1,3-dioxolane-2-thione |
| SMILES | CCC1COC(=S)O1 |
| InChI | InChI=1S/C5H8O2S/c1-2-4-3-6-5(8)7-4/h4H,2-3H2,1H3 |
| InChIKey | SJHLMLJMSSTVNA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|