C21H30ClN5O5 — CID 15078544
4-amino-5-chloro-2-methoxy-N-[(3S,4R)-3-methoxy-1-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)propyl]piperidin-4-yl]benzamide (PubChem CID 15078544) has the molecular formula C21H30ClN5O5 and a molecular weight of 467.95 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[(3S,4R)-3-methoxy-1-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)propyl]piperidin-4-yl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[(3S,4R)-3-methoxy-1-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)propyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 15078544 |
| Molecular Formula | C21H30ClN5O5 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[(3S,4R)-3-methoxy-1-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)propyl]piperidin-4-yl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@@H]1CCN(CCCC2(C)NC(=O)NC2=O)C[C@@H]1OC |
| InChI | InChI=1S/C21H30ClN5O5/c1-21(19(29)25-20(30)26-21)6-4-7-27-8-5-15(17(11-27)32-3)24-18(28)12-9-13(22)14(23)10-16(12)31-2/h9-10,15,17H,4-8,11,23H2,1-3H3,(H,24,28)(H2,25,26,29,30)/t15-,17+,21?/m1/s1 |
| InChIKey | OCMBTZDUXOJKGS-XZFDIXFUSA-N |
| XLogP | 1.13 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|