C11H15N3 — CID 150814806
2-N-propyl-1H-indole-2,3-diamine (PubChem CID 150814806) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-N-propyl-1H-indole-2,3-diamine.
| Compound Name | 2-N-propyl-1H-indole-2,3-diamine |
|---|---|
| PubChem CID | 150814806 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-N-propyl-1H-indole-2,3-diamine |
| SMILES | CCCNc1[nH]c2ccccc2c1N |
| InChI | InChI=1S/C11H15N3/c1-2-7-13-11-10(12)8-5-3-4-6-9(8)14-11/h3-6,13-14H,2,7,12H2,1H3 |
| InChIKey | KIQMDULOKICGMM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |