C5H5NO6 — CID 150921913
aziridine-1,2,2-tricarboxylic acid (PubChem CID 150921913) has the molecular formula C5H5NO6 and a molecular weight of 175.10 g/mol. Its IUPAC name is aziridine-1,2,2-tricarboxylic acid.
| Compound Name | aziridine-1,2,2-tricarboxylic acid |
|---|---|
| PubChem CID | 150921913 |
| Molecular Formula | C5H5NO6 |
| Molecular Weight | 175.10 g/mol |
| Exact Mass | 175.01 |
| IUPAC Name | aziridine-1,2,2-tricarboxylic acid |
| SMILES | O=C(O)N1CC1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C5H5NO6/c7-2(8)5(3(9)10)1-6(5)4(11)12/h1H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | LEEXKKICYNGOAC-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.10 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|