C16H18F3N3O3S3 — CID 150995453
1,1,1-trifluoro-2-[4-[(2S)-2-sulfanyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenyl]propan-2-ol (PubChem CID 150995453) has the molecular formula C16H18F3N3O3S3 and a molecular weight of 453.53 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[4-[(2S)-2-sulfanyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[4-[(2S)-2-sulfanyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 150995453 |
| Molecular Formula | C16H18F3N3O3S3 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 1,1,1-trifluoro-2-[4-[(2S)-2-sulfanyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenyl]propan-2-ol |
| SMILES | CC(O)(c1ccc(N2CCN(S(=O)(=O)c3nccs3)C[C@@H]2S)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H18F3N3O3S3/c1-15(23,16(17,18)19)11-2-4-12(5-3-11)22-8-7-21(10-13(22)26)28(24,25)14-20-6-9-27-14/h2-6,9,13,23,26H,7-8,10H2,1H3/t13-,15?/m0/s1 |
| InChIKey | LSZPPSZGKQNFTG-CFMCSPIPSA-N |
| XLogP | 2.68 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|