C17H23N3O3S2 — CID 70659402
2-[4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenyl]propan-2-ol (PubChem CID 70659402) has the molecular formula C17H23N3O3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-[4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 70659402 |
| Molecular Formula | C17H23N3O3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-[4-[(2S)-2-methyl-4-(1,3-thiazol-2-ylsulfonyl)piperazin-1-yl]phenyl]propan-2-ol |
| SMILES | C[C@H]1CN(S(=O)(=O)c2nccs2)CCN1c1ccc(C(C)(C)O)cc1 |
| InChI | InChI=1S/C17H23N3O3S2/c1-13-12-19(25(22,23)16-18-8-11-24-16)9-10-20(13)15-6-4-14(5-7-15)17(2,3)21/h4-8,11,13,21H,9-10,12H2,1-3H3/t13-/m0/s1 |
| InChIKey | MWFRDJWMWJOXHN-ZDUSSCGKSA-N |
| XLogP | 2.27 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|