C25H28ClN3O5S2 — CID 88878235
2-[4-[(2R)-2-(benzenesulfonylmethyl)-4-[(6-chloro-3-pyridinyl)sulfonyl]piperazin-1-yl]phenyl]propan-2-ol (PubChem CID 88878235) has the molecular formula C25H28ClN3O5S2 and a molecular weight of 550.10 g/mol. Its IUPAC name is 2-[4-[(2R)-2-(benzenesulfonylmethyl)-4-[(6-chloro-3-pyridinyl)sulfonyl]piperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[(2R)-2-(benzenesulfonylmethyl)-4-[(6-chloro-3-pyridinyl)sulfonyl]piperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 88878235 |
| Molecular Formula | C25H28ClN3O5S2 |
| Molecular Weight | 550.10 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | 2-[4-[(2R)-2-(benzenesulfonylmethyl)-4-[(6-chloro-3-pyridinyl)sulfonyl]piperazin-1-yl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(N2CCN(S(=O)(=O)c3ccc(Cl)nc3)C[C@@H]2CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H28ClN3O5S2/c1-25(2,30)19-8-10-20(11-9-19)29-15-14-28(36(33,34)23-12-13-24(26)27-16-23)17-21(29)18-35(31,32)22-6-4-3-5-7-22/h3-13,16,21,30H,14-15,17-18H2,1-2H3/t21-/m1/s1 |
| InChIKey | LZWFBRGZXLNOEM-OAQYLSRUSA-N |
| XLogP | 3.32 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.10 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|