C20H25F3N4O2 — CID 151183907
6-methyl-2-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-2H-pyrazine-3,5-dione (PubChem CID 151183907) has the molecular formula C20H25F3N4O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 6-methyl-2-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-2H-pyrazine-3,5-dione.
| Compound Name | 6-methyl-2-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-2H-pyrazine-3,5-dione |
|---|---|
| PubChem CID | 151183907 |
| Molecular Formula | C20H25F3N4O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 6-methyl-2-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-2H-pyrazine-3,5-dione |
| SMILES | CC1=NC(CCCCN2CCN(c3cccc(C(F)(F)F)c3)CC2)C(=O)NC1=O |
| InChI | InChI=1S/C20H25F3N4O2/c1-14-18(28)25-19(29)17(24-14)7-2-3-8-26-9-11-27(12-10-26)16-6-4-5-15(13-16)20(21,22)23/h4-6,13,17H,2-3,7-12H2,1H3,(H,25,28,29) |
| InChIKey | NEWNXFNKKAAJPW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|